C13H21F4NO3 — CID 103474758
1-(2,6-dioxaspiro[4.5]decan-9-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103474758) has the molecular formula C13H21F4NO3 and a molecular weight of 315.31 g/mol. Its IUPAC name is 1-(2,6-dioxaspiro[4.5]decan-9-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(2,6-dioxaspiro[4.5]decan-9-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103474758 |
| Molecular Formula | C13H21F4NO3 |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-(2,6-dioxaspiro[4.5]decan-9-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | NC(COCC(F)(F)C(F)F)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C13H21F4NO3/c14-11(15)13(16,17)8-20-6-10(18)9-1-3-21-12(5-9)2-4-19-7-12/h9-11H,1-8,18H2 |
| InChIKey | AEDRJRJJQWCXQQ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|