C9H11F4NOS — CID 103474856
2-(2,2,3,3-tetrafluoropropoxy)-1-thiophen-3-ylethanamine (PubChem CID 103474856) has the molecular formula C9H11F4NOS and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxy)-1-thiophen-3-ylethanamine.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxy)-1-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 103474856 |
| Molecular Formula | C9H11F4NOS |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxy)-1-thiophen-3-ylethanamine |
| SMILES | NC(COCC(F)(F)C(F)F)c1ccsc1 |
| InChI | InChI=1S/C9H11F4NOS/c10-8(11)9(12,13)5-15-3-7(14)6-1-2-16-4-6/h1-2,4,7-8H,3,5,14H2 |
| InChIKey | MTXWTNIMSPSUBE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|