C8H13F4NO — CID 103474867
3-methyl-1-(2,2,3,3-tetrafluoropropoxy)but-3-en-2-amine (PubChem CID 103474867) has the molecular formula C8H13F4NO and a molecular weight of 215.19 g/mol. Its IUPAC name is 3-methyl-1-(2,2,3,3-tetrafluoropropoxy)but-3-en-2-amine.
| Compound Name | 3-methyl-1-(2,2,3,3-tetrafluoropropoxy)but-3-en-2-amine |
|---|---|
| PubChem CID | 103474867 |
| Molecular Formula | C8H13F4NO |
| Molecular Weight | 215.19 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-methyl-1-(2,2,3,3-tetrafluoropropoxy)but-3-en-2-amine |
| SMILES | C=C(C)C(N)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H13F4NO/c1-5(2)6(13)3-14-4-8(11,12)7(9)10/h6-7H,1,3-4,13H2,2H3 |
| InChIKey | IJKQQWJBRIBRRC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|