C12H21F4NO3S — CID 103474877
1-(3-methylsulfonylcyclohexyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103474877) has the molecular formula C12H21F4NO3S and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-(3-methylsulfonylcyclohexyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(3-methylsulfonylcyclohexyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103474877 |
| Molecular Formula | C12H21F4NO3S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-(3-methylsulfonylcyclohexyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CS(=O)(=O)C1CCCC(C(N)COCC(F)(F)C(F)F)C1 |
| InChI | InChI=1S/C12H21F4NO3S/c1-21(18,19)9-4-2-3-8(5-9)10(17)6-20-7-12(15,16)11(13)14/h8-11H,2-7,17H2,1H3 |
| InChIKey | FKTIVOACYDBKRO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|