C9H17F4NO3S — CID 103474900
5-methylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine (PubChem CID 103474900) has the molecular formula C9H17F4NO3S and a molecular weight of 295.30 g/mol. Its IUPAC name is 5-methylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine.
| Compound Name | 5-methylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine |
|---|---|
| PubChem CID | 103474900 |
| Molecular Formula | C9H17F4NO3S |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 5-methylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine |
| SMILES | CS(=O)(=O)CCCC(N)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H17F4NO3S/c1-18(15,16)4-2-3-7(14)5-17-6-9(12,13)8(10)11/h7-8H,2-6,14H2,1H3 |
| InChIKey | JWXLRBJVCQLOCC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|