C14H14F4N2O — CID 103475056
1-quinolin-7-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475056) has the molecular formula C14H14F4N2O and a molecular weight of 302.27 g/mol. Its IUPAC name is 1-quinolin-7-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-quinolin-7-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475056 |
| Molecular Formula | C14H14F4N2O |
| Molecular Weight | 302.27 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-quinolin-7-yl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | NC(COCC(F)(F)C(F)F)c1ccc2cccnc2c1 |
| InChI | InChI=1S/C14H14F4N2O/c15-13(16)14(17,18)8-21-7-11(19)10-4-3-9-2-1-5-20-12(9)6-10/h1-6,11,13H,7-8,19H2 |
| InChIKey | VBAVKHXIFWHZPB-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|