C9H12ClF4N3O — CID 103475127
1-(4-chloro-1-methylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475127) has the molecular formula C9H12ClF4N3O and a molecular weight of 289.66 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475127 |
| Molecular Formula | C9H12ClF4N3O |
| Molecular Weight | 289.66 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | Cn1ncc(Cl)c1C(N)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C9H12ClF4N3O/c1-17-7(5(10)2-16-17)6(15)3-18-4-9(13,14)8(11)12/h2,6,8H,3-4,15H2,1H3 |
| InChIKey | PDWWXLXKWHBGDH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.66 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|