C11H16ClF4N3O — CID 103475231
1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475231) has the molecular formula C11H16ClF4N3O and a molecular weight of 317.71 g/mol. Its IUPAC name is 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475231 |
| Molecular Formula | C11H16ClF4N3O |
| Molecular Weight | 317.71 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-(4-chloro-1-propan-2-ylpyrazol-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CC(C)n1ncc(Cl)c1C(N)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C11H16ClF4N3O/c1-6(2)19-9(7(12)3-18-19)8(17)4-20-5-11(15,16)10(13)14/h3,6,8,10H,4-5,17H2,1-2H3 |
| InChIKey | VWFGSINCZSIDKJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|