C12H18F4N2OS — CID 103475327
1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine (PubChem CID 103475327) has the molecular formula C12H18F4N2OS and a molecular weight of 314.35 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine.
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
|---|---|
| PubChem CID | 103475327 |
| Molecular Formula | C12H18F4N2OS |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)-N-methyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
| SMILES | CNC(COCC(F)(F)C(F)F)Cc1nc(C)c(C)s1 |
| InChI | InChI=1S/C12H18F4N2OS/c1-7-8(2)20-10(18-7)4-9(17-3)5-19-6-12(15,16)11(13)14/h9,11,17H,4-6H2,1-3H3 |
| InChIKey | OKUBNBMPHYJXNP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|