C14H36F4O6P2Si4 — CID 10347535
[[2-bis(trimethylsilyloxy)phosphoryl-1,1,2,2-tetrafluoroethyl]-trimethylsilyloxyphosphoryl]oxy-trimethylsilane (PubChem CID 10347535) has the molecular formula C14H36F4O6P2Si4 and a molecular weight of 550.72 g/mol. Its IUPAC name is [[2-bis(trimethylsilyloxy)phosphoryl-1,1,2,2-tetrafluoroethyl]-trimethylsilyloxyphosphoryl]oxy-trimethylsilane.
| Compound Name | [[2-bis(trimethylsilyloxy)phosphoryl-1,1,2,2-tetrafluoroethyl]-trimethylsilyloxyphosphoryl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10347535 |
| Molecular Formula | C14H36F4O6P2Si4 |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | [[2-bis(trimethylsilyloxy)phosphoryl-1,1,2,2-tetrafluoroethyl]-trimethylsilyloxyphosphoryl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OP(=O)(O[Si](C)(C)C)C(F)(F)C(F)(F)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H36F4O6P2Si4/c1-27(2,3)21-25(19,22-28(4,5)6)13(15,16)14(17,18)26(20,23-29(7,8)9)24-30(10,11)12/h1-12H3 |
| InChIKey | TZCCHXCESOTUNA-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|