C10H15F4NO2 — CID 103475352
1-(2,3-dihydrofuran-5-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475352) has the molecular formula C10H15F4NO2 and a molecular weight of 257.23 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475352 |
| Molecular Formula | C10H15F4NO2 |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CNC(COCC(F)(F)C(F)F)C1=CCCO1 |
| InChI | InChI=1S/C10H15F4NO2/c1-15-7(8-3-2-4-17-8)5-16-6-10(13,14)9(11)12/h3,7,9,15H,2,4-6H2,1H3 |
| InChIKey | ZVKMHJXAMNZHKC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|