C14H18F4N2O — CID 103475455
1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475455) has the molecular formula C14H18F4N2O and a molecular weight of 306.30 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475455 |
| Molecular Formula | C14H18F4N2O |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CNC(COCC(F)(F)C(F)F)C1CCc2cccnc21 |
| InChI | InChI=1S/C14H18F4N2O/c1-19-11(7-21-8-14(17,18)13(15)16)10-5-4-9-3-2-6-20-12(9)10/h2-3,6,10-11,13,19H,4-5,7-8H2,1H3 |
| InChIKey | PECNYNPZRWDTHM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|