C14H25F4NO — CID 103475520
1-(3,4-dimethylcyclohexyl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475520) has the molecular formula C14H25F4NO and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475520 |
| Molecular Formula | C14H25F4NO |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CNC(COCC(F)(F)C(F)F)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C14H25F4NO/c1-9-4-5-11(6-10(9)2)12(19-3)7-20-8-14(17,18)13(15)16/h9-13,19H,4-8H2,1-3H3 |
| InChIKey | BWTIFIOLXQEXMB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|