C10H12BrF4NOS — CID 103475529
1-(4-bromothiophen-3-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475529) has the molecular formula C10H12BrF4NOS and a molecular weight of 350.18 g/mol. Its IUPAC name is 1-(4-bromothiophen-3-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(4-bromothiophen-3-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475529 |
| Molecular Formula | C10H12BrF4NOS |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 1-(4-bromothiophen-3-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CNC(COCC(F)(F)C(F)F)c1cscc1Br |
| InChI | InChI=1S/C10H12BrF4NOS/c1-16-8(6-3-18-4-7(6)11)2-17-5-10(14,15)9(12)13/h3-4,8-9,16H,2,5H2,1H3 |
| InChIKey | QMAALDJGNZZZBC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|