C10H14ClF4N3O — CID 103475605
1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475605) has the molecular formula C10H14ClF4N3O and a molecular weight of 303.69 g/mol. Its IUPAC name is 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475605 |
| Molecular Formula | C10H14ClF4N3O |
| Molecular Weight | 303.69 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 1-(4-chloro-1-methylpyrazol-5-yl)-N-methyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CNC(COCC(F)(F)C(F)F)c1c(Cl)cnn1C |
| InChI | InChI=1S/C10H14ClF4N3O/c1-16-7(8-6(11)3-17-18(8)2)4-19-5-10(14,15)9(12)13/h3,7,9,16H,4-5H2,1-2H3 |
| InChIKey | UYOBZOGROXHFIU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.69 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|