C12H19F4N3O — CID 103475633
N-methyl-1-(2-propylpyrazol-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475633) has the molecular formula C12H19F4N3O and a molecular weight of 297.30 g/mol. Its IUPAC name is N-methyl-1-(2-propylpyrazol-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | N-methyl-1-(2-propylpyrazol-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475633 |
| Molecular Formula | C12H19F4N3O |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-methyl-1-(2-propylpyrazol-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CCCn1nccc1C(COCC(F)(F)C(F)F)NC |
| InChI | InChI=1S/C12H19F4N3O/c1-3-6-19-10(4-5-18-19)9(17-2)7-20-8-12(15,16)11(13)14/h4-5,9,11,17H,3,6-8H2,1-2H3 |
| InChIKey | RLBFTUWVISLPAO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|