C11H19F4NO — CID 103475640
N-methyl-1-(2,2,3,3-tetrafluoropropoxy)hept-6-en-2-amine (PubChem CID 103475640) has the molecular formula C11H19F4NO and a molecular weight of 257.27 g/mol. Its IUPAC name is N-methyl-1-(2,2,3,3-tetrafluoropropoxy)hept-6-en-2-amine.
| Compound Name | N-methyl-1-(2,2,3,3-tetrafluoropropoxy)hept-6-en-2-amine |
|---|---|
| PubChem CID | 103475640 |
| Molecular Formula | C11H19F4NO |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-methyl-1-(2,2,3,3-tetrafluoropropoxy)hept-6-en-2-amine |
| SMILES | C=CCCCC(COCC(F)(F)C(F)F)NC |
| InChI | InChI=1S/C11H19F4NO/c1-3-4-5-6-9(16-2)7-17-8-11(14,15)10(12)13/h3,9-10,16H,1,4-8H2,2H3 |
| InChIKey | GPQPFMWPBBTBOC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|