C14H23F4NO2 — CID 103475684
N-methyl-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475684) has the molecular formula C14H23F4NO2 and a molecular weight of 313.34 g/mol. Its IUPAC name is N-methyl-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | N-methyl-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475684 |
| Molecular Formula | C14H23F4NO2 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-methyl-1-(5-oxaspiro[3.5]nonan-8-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CNC(COCC(F)(F)C(F)F)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C14H23F4NO2/c1-19-11(8-20-9-14(17,18)12(15)16)10-3-6-21-13(7-10)4-2-5-13/h10-12,19H,2-9H2,1H3 |
| InChIKey | LQNRABKSQXKKOS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|