C13H25F4NO2 — CID 103475699
N-ethyl-5-methoxy-5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hexan-2-amine (PubChem CID 103475699) has the molecular formula C13H25F4NO2 and a molecular weight of 303.34 g/mol. Its IUPAC name is N-ethyl-5-methoxy-5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hexan-2-amine.
| Compound Name | N-ethyl-5-methoxy-5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hexan-2-amine |
|---|---|
| PubChem CID | 103475699 |
| Molecular Formula | C13H25F4NO2 |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N-ethyl-5-methoxy-5-methyl-1-(2,2,3,3-tetrafluoropropoxy)hexan-2-amine |
| SMILES | CCNC(CCC(C)(C)OC)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H25F4NO2/c1-5-18-10(6-7-12(2,3)19-4)8-20-9-13(16,17)11(14)15/h10-11,18H,5-9H2,1-4H3 |
| InChIKey | KKWTVQWKAALNDM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|