C15H27F4NO — CID 103475793
1-(3,4-dimethylcyclohexyl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 103475793) has the molecular formula C15H27F4NO and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 103475793 |
| Molecular Formula | C15H27F4NO |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CCNC(COCC(F)(F)C(F)F)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C15H27F4NO/c1-4-20-13(8-21-9-15(18,19)14(16)17)12-6-5-10(2)11(3)7-12/h10-14,20H,4-9H2,1-3H3 |
| InChIKey | SIAZBUVSRLXOER-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|