C12H16BrF4NOS — CID 103475928
N-[1-(4-bromothiophen-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine (PubChem CID 103475928) has the molecular formula C12H16BrF4NOS and a molecular weight of 378.23 g/mol. Its IUPAC name is N-[1-(4-bromothiophen-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine.
| Compound Name | N-[1-(4-bromothiophen-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103475928 |
| Molecular Formula | C12H16BrF4NOS |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | N-[1-(4-bromothiophen-3-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine |
| SMILES | CCCNC(COCC(F)(F)C(F)F)c1cscc1Br |
| InChI | InChI=1S/C12H16BrF4NOS/c1-2-3-18-10(8-5-20-6-9(8)13)4-19-7-12(16,17)11(14)15/h5-6,10-11,18H,2-4,7H2,1H3 |
| InChIKey | VBDXXFIGEHOUIY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|