C13H21F4NO2 — CID 103475952
N-[1-(3,4-dihydro-2H-pyran-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine (PubChem CID 103475952) has the molecular formula C13H21F4NO2 and a molecular weight of 299.31 g/mol. Its IUPAC name is N-[1-(3,4-dihydro-2H-pyran-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine.
| Compound Name | N-[1-(3,4-dihydro-2H-pyran-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103475952 |
| Molecular Formula | C13H21F4NO2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-[1-(3,4-dihydro-2H-pyran-5-yl)-2-(2,2,3,3-tetrafluoropropoxy)ethyl]propan-1-amine |
| SMILES | CCCNC(COCC(F)(F)C(F)F)C1=COCCC1 |
| InChI | InChI=1S/C13H21F4NO2/c1-2-5-18-11(10-4-3-6-19-7-10)8-20-9-13(16,17)12(14)15/h7,11-12,18H,2-6,8-9H2,1H3 |
| InChIKey | GZDPNZWDKFKARE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|