C11H16F4N2OS — CID 103476016
N-methyl-1-[4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 103476016) has the molecular formula C11H16F4N2OS and a molecular weight of 300.32 g/mol. Its IUPAC name is N-methyl-1-[4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine.
| Compound Name | N-methyl-1-[4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103476016 |
| Molecular Formula | C11H16F4N2OS |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | N-methyl-1-[4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | CNC(C)c1sc(COCC(F)(F)C(F)F)nc1C |
| InChI | InChI=1S/C11H16F4N2OS/c1-6(16-3)9-7(2)17-8(19-9)4-18-5-11(14,15)10(12)13/h6,10,16H,4-5H2,1-3H3 |
| InChIKey | JIQXBKMDZZJEKX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|