C12H18F4N2OS — CID 103476018
N-ethyl-1-[4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 103476018) has the molecular formula C12H18F4N2OS and a molecular weight of 314.35 g/mol. Its IUPAC name is N-ethyl-1-[4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine.
| Compound Name | N-ethyl-1-[4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103476018 |
| Molecular Formula | C12H18F4N2OS |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-ethyl-1-[4-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | CCNC(C)c1sc(COCC(F)(F)C(F)F)nc1C |
| InChI | InChI=1S/C12H18F4N2OS/c1-4-17-7(2)10-8(3)18-9(20-10)5-19-6-12(15,16)11(13)14/h7,11,17H,4-6H2,1-3H3 |
| InChIKey | PCDWKZPFPPUQDU-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|