C12H16F4N2OS — CID 103476033
N-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine (PubChem CID 103476033) has the molecular formula C12H16F4N2OS and a molecular weight of 312.33 g/mol. Its IUPAC name is N-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine.
| Compound Name | N-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
|---|---|
| PubChem CID | 103476033 |
| Molecular Formula | C12H16F4N2OS |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-methyl-2-(2,2,3,3-tetrafluoropropoxymethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-amine |
| SMILES | CNC1CCCc2nc(COCC(F)(F)C(F)F)sc21 |
| InChI | InChI=1S/C12H16F4N2OS/c1-17-7-3-2-4-8-10(7)20-9(18-8)5-19-6-12(15,16)11(13)14/h7,11,17H,2-6H2,1H3 |
| InChIKey | RUYMXRQLWKQZKY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|