C9H12F4N2OS — CID 103476043
1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 103476043) has the molecular formula C9H12F4N2OS and a molecular weight of 272.27 g/mol. Its IUPAC name is 1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine.
| Compound Name | 1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103476043 |
| Molecular Formula | C9H12F4N2OS |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | CC(N)c1cnc(COCC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C9H12F4N2OS/c1-5(14)6-2-15-7(17-6)3-16-4-9(12,13)8(10)11/h2,5,8H,3-4,14H2,1H3 |
| InChIKey | XWSYACQQRZAFFZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|