C10H14F4N2OS — CID 103476045
N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 103476045) has the molecular formula C10H14F4N2OS and a molecular weight of 286.29 g/mol. Its IUPAC name is N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine.
| Compound Name | N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 103476045 |
| Molecular Formula | C10H14F4N2OS |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | CNC(C)c1cnc(COCC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C10H14F4N2OS/c1-6(15-2)7-3-16-8(18-7)4-17-5-10(13,14)9(11)12/h3,6,9,15H,4-5H2,1-2H3 |
| InChIKey | RNYVZYLKVDCTPS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|