C11H13F4NO2S — CID 103476123
2-(2,2,3,3-tetrafluoropropoxymethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol (PubChem CID 103476123) has the molecular formula C11H13F4NO2S and a molecular weight of 299.29 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluoropropoxymethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol.
| Compound Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
|---|---|
| PubChem CID | 103476123 |
| Molecular Formula | C11H13F4NO2S |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-(2,2,3,3-tetrafluoropropoxymethyl)-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
| SMILES | OC1CCCc2nc(COCC(F)(F)C(F)F)sc21 |
| InChI | InChI=1S/C11H13F4NO2S/c12-10(13)11(14,15)5-18-4-8-16-6-2-1-3-7(17)9(6)19-8/h7,10,17H,1-5H2 |
| InChIKey | YSAWAYFMZUDQBK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|