C9H11F4NO2S — CID 103476129
1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]ethanol (PubChem CID 103476129) has the molecular formula C9H11F4NO2S and a molecular weight of 273.25 g/mol. Its IUPAC name is 1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]ethanol.
| Compound Name | 1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]ethanol |
|---|---|
| PubChem CID | 103476129 |
| Molecular Formula | C9H11F4NO2S |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-4-yl]ethanol |
| SMILES | CC(O)c1csc(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C9H11F4NO2S/c1-5(15)6-3-17-7(14-6)2-16-4-9(12,13)8(10)11/h3,5,8,15H,2,4H2,1H3 |
| InChIKey | KKUPSSDUBIYYIL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|