C29H30N8O4 — CID 10347628
(2S,3S,4R,5R)-N-cyclopropyl-3,4-dihydroxy-5-[6-[2-[1-(pyridin-3-ylmethyl)indol-3-yl]ethylamino]purin-9-yl]oxolane-2-carboxamide (PubChem CID 10347628) has the molecular formula C29H30N8O4 and a molecular weight of 554.61 g/mol. Its IUPAC name is (2S,3S,4R,5R)-N-cyclopropyl-3,4-dihydroxy-5-[6-[2-[1-(pyridin-3-ylmethyl)indol-3-yl]ethylamino]purin-9-yl]oxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-N-cyclopropyl-3,4-dihydroxy-5-[6-[2-[1-(pyridin-3-ylmethyl)indol-3-yl]ethylamino]purin-9-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 10347628 |
| Molecular Formula | C29H30N8O4 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | (2S,3S,4R,5R)-N-cyclopropyl-3,4-dihydroxy-5-[6-[2-[1-(pyridin-3-ylmethyl)indol-3-yl]ethylamino]purin-9-yl]oxolane-2-carboxamide |
| SMILES | O=C(NC1CC1)[C@H]1O[C@@H](n2cnc3c(NCCc4cn(Cc5cccnc5)c5ccccc45)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H30N8O4/c38-23-24(39)29(41-25(23)28(40)35-19-7-8-19)37-16-34-22-26(32-15-33-27(22)37)31-11-9-18-14-36(13-17-4-3-10-30-12-17)21-6-2-1-5-20(18)21/h1-6,10,12,14-16,19,23-25,29,38-39H,7-9,11,13H2,(H,35,40)(H,31,32,33)/t23-,24+,25-,29+/m0/s1 |
| InChIKey | UWCSQFOSFWEWIQ-APSVEGKFSA-N |
| XLogP | 1.78 |
| TPSA | 152.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |