C8H12F3N3O3 — CID 103476522
N-(2-methoxyethyl)-3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-amine (PubChem CID 103476522) has the molecular formula C8H12F3N3O3 and a molecular weight of 255.20 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | N-(2-methoxyethyl)-3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 103476522 |
| Molecular Formula | C8H12F3N3O3 |
| Molecular Weight | 255.20 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(2-methoxyethyl)-3-(2,2,2-trifluoroethoxymethyl)-1,2,4-oxadiazol-5-amine |
| SMILES | COCCNc1nc(COCC(F)(F)F)no1 |
| InChI | InChI=1S/C8H12F3N3O3/c1-15-3-2-12-7-13-6(14-17-7)4-16-5-8(9,10)11/h2-5H2,1H3,(H,12,13,14) |
| InChIKey | SCQWQRDEZZPJQI-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|