C9H13F4N3O — CID 103476695
N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-imidazol-5-yl]methanamine (PubChem CID 103476695) has the molecular formula C9H13F4N3O and a molecular weight of 255.21 g/mol. Its IUPAC name is N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-imidazol-5-yl]methanamine.
| Compound Name | N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-imidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 103476695 |
| Molecular Formula | C9H13F4N3O |
| Molecular Weight | 255.21 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | N-methyl-1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1H-imidazol-5-yl]methanamine |
| SMILES | CNCc1cnc(COCC(F)(F)C(F)F)[nH]1 |
| InChI | InChI=1S/C9H13F4N3O/c1-14-2-6-3-15-7(16-6)4-17-5-9(12,13)8(10)11/h3,8,14H,2,4-5H2,1H3,(H,15,16) |
| InChIKey | WALMAJBXCUQRRV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|