C10H14F4N4O — CID 103476935
4-propan-2-yl-6-(2,2,3,3-tetrafluoropropoxymethyl)-1,3,5-triazin-2-amine (PubChem CID 103476935) has the molecular formula C10H14F4N4O and a molecular weight of 282.24 g/mol. Its IUPAC name is 4-propan-2-yl-6-(2,2,3,3-tetrafluoropropoxymethyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-propan-2-yl-6-(2,2,3,3-tetrafluoropropoxymethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 103476935 |
| Molecular Formula | C10H14F4N4O |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-propan-2-yl-6-(2,2,3,3-tetrafluoropropoxymethyl)-1,3,5-triazin-2-amine |
| SMILES | CC(C)c1nc(N)nc(COCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C10H14F4N4O/c1-5(2)7-16-6(17-9(15)18-7)3-19-4-10(13,14)8(11)12/h5,8H,3-4H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | VJYPKBYQEPSMDF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|