C14H18F3N3O — CID 103477264
4-cyclobutyl-2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 103477264) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 4-cyclobutyl-2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 4-cyclobutyl-2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 103477264 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 4-cyclobutyl-2-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | FC(F)(F)COCc1nc2c(c(C3CCC3)n1)CNCC2 |
| InChI | InChI=1S/C14H18F3N3O/c15-14(16,17)8-21-7-12-19-11-4-5-18-6-10(11)13(20-12)9-2-1-3-9/h9,18H,1-8H2 |
| InChIKey | OYRDFXQJOHTJDJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |