C9H14F4N2O — CID 103477557
1-(2,2,3,3-tetrafluoropropoxy)hex-5-yn-2-ylhydrazine (PubChem CID 103477557) has the molecular formula C9H14F4N2O and a molecular weight of 242.22 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropoxy)hex-5-yn-2-ylhydrazine.
| Compound Name | 1-(2,2,3,3-tetrafluoropropoxy)hex-5-yn-2-ylhydrazine |
|---|---|
| PubChem CID | 103477557 |
| Molecular Formula | C9H14F4N2O |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropoxy)hex-5-yn-2-ylhydrazine |
| SMILES | C#CCCC(COCC(F)(F)C(F)F)NN |
| InChI | InChI=1S/C9H14F4N2O/c1-2-3-4-7(15-14)5-16-6-9(12,13)8(10)11/h1,7-8,15H,3-6,14H2 |
| InChIKey | YFDKRDHSDUOAHN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|