C30H29N3O8 — CID 10347756
(4-nitrophenyl)methyl (6S,6aS,8Z)-8-ethylidene-6-hydroxy-2-methoxy-11-oxo-3-phenylmethoxy-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 10347756) has the molecular formula C30H29N3O8 and a molecular weight of 559.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S,6aS,8Z)-8-ethylidene-6-hydroxy-2-methoxy-11-oxo-3-phenylmethoxy-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S,6aS,8Z)-8-ethylidene-6-hydroxy-2-methoxy-11-oxo-3-phenylmethoxy-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 10347756 |
| Molecular Formula | C30H29N3O8 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | (4-nitrophenyl)methyl (6S,6aS,8Z)-8-ethylidene-6-hydroxy-2-methoxy-11-oxo-3-phenylmethoxy-6,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | C/C=C1/C[C@H]2[C@H](O)N(C(=O)OCc3ccc([N+](=O)[O-])cc3)c3cc(OCc4ccccc4)c(OC)cc3C(=O)N2C1 |
| InChI | InChI=1S/C30H29N3O8/c1-3-19-13-25-29(35)32(30(36)41-18-21-9-11-22(12-10-21)33(37)38)24-15-27(40-17-20-7-5-4-6-8-20)26(39-2)14-23(24)28(34)31(25)16-19/h3-12,14-15,25,29,35H,13,16-18H2,1-2H3/b19-3-/t25-,29-/m0/s1 |
| InChIKey | IYOSYBSZIDRALB-JIQVABJRSA-N |
| XLogP | 4.82 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|