C11H20F4N2O — CID 103477650
[1-cyclopentyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine (PubChem CID 103477650) has the molecular formula C11H20F4N2O and a molecular weight of 272.29 g/mol. Its IUPAC name is [1-cyclopentyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine.
| Compound Name | [1-cyclopentyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477650 |
| Molecular Formula | C11H20F4N2O |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | [1-cyclopentyl-3-(2,2,3,3-tetrafluoropropoxy)propan-2-yl]hydrazine |
| SMILES | NNC(COCC(F)(F)C(F)F)CC1CCCC1 |
| InChI | InChI=1S/C11H20F4N2O/c12-10(13)11(14,15)7-18-6-9(17-16)5-8-3-1-2-4-8/h8-10,17H,1-7,16H2 |
| InChIKey | UXGRRBLSUFLLLV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|