C10H20F4N2O3S — CID 103477812
[5-ethylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-yl]hydrazine (PubChem CID 103477812) has the molecular formula C10H20F4N2O3S and a molecular weight of 324.34 g/mol. Its IUPAC name is [5-ethylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-yl]hydrazine.
| Compound Name | [5-ethylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103477812 |
| Molecular Formula | C10H20F4N2O3S |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [5-ethylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-yl]hydrazine |
| SMILES | CCS(=O)(=O)CCCC(COCC(F)(F)C(F)F)NN |
| InChI | InChI=1S/C10H20F4N2O3S/c1-2-20(17,18)5-3-4-8(16-15)6-19-7-10(13,14)9(11)12/h8-9,16H,2-7,15H2,1H3 |
| InChIKey | NPLJWZCBXXKHOD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|