C32H38O5SSi — CID 10347848
methyl 2-[(2R,3R,4R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-methyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate (PubChem CID 10347848) has the molecular formula C32H38O5SSi and a molecular weight of 562.80 g/mol. Its IUPAC name is methyl 2-[(2R,3R,4R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-methyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate.
| Compound Name | methyl 2-[(2R,3R,4R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-methyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10347848 |
| Molecular Formula | C32H38O5SSi |
| Molecular Weight | 562.80 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | methyl 2-[(2R,3R,4R)-2-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-methyl-5-oxo-4-phenylsulfanyloxolan-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(=O)[C@]1(C)Sc1ccccc1 |
| InChI | InChI=1S/C32H38O5SSi/c1-31(2,3)39(25-17-11-7-12-18-25,26-19-13-8-14-20-26)36-22-21-28-27(23-29(33)35-5)32(4,30(34)37-28)38-24-15-9-6-10-16-24/h6-20,27-28H,21-23H2,1-5H3/t27-,28-,32-/m1/s1 |
| InChIKey | KFKXNOUATAZFNV-DMBDEWFESA-N |
| XLogP | 5.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.80 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|