C35H40N4O3 — CID 10347903
N-[4-[4-[1-(2-amino-2-oxoethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide (PubChem CID 10347903) has the molecular formula C35H40N4O3 and a molecular weight of 564.73 g/mol. Its IUPAC name is N-[4-[4-[1-(2-amino-2-oxoethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide.
| Compound Name | N-[4-[4-[1-(2-amino-2-oxoethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide |
|---|---|
| PubChem CID | 10347903 |
| Molecular Formula | C35H40N4O3 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | N-[4-[4-[1-(2-amino-2-oxoethoxy)-5,6,7,8-tetrahydronaphthalen-2-yl]piperidin-1-yl]butyl]-4-(4-cyanophenyl)benzamide |
| SMILES | N#Cc1ccc(-c2ccc(C(=O)NCCCCN3CCC(c4ccc5c(c4OCC(N)=O)CCCC5)CC3)cc2)cc1 |
| InChI | InChI=1S/C35H40N4O3/c36-23-25-7-9-26(10-8-25)27-11-13-30(14-12-27)35(41)38-19-3-4-20-39-21-17-29(18-22-39)32-16-15-28-5-1-2-6-31(28)34(32)42-24-33(37)40/h7-16,29H,1-6,17-22,24H2,(H2,37,40)(H,38,41) |
| InChIKey | UIIYOZWFPVPIOZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 108.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|