C11H14BrClN2O — CID 103479404
(2R)-2-amino-N-(2-bromo-3-chlorophenyl)-3-methylbutanamide (PubChem CID 103479404) has the molecular formula C11H14BrClN2O and a molecular weight of 305.60 g/mol. Its IUPAC name is (2R)-2-amino-N-(2-bromo-3-chlorophenyl)-3-methylbutanamide.
| Compound Name | (2R)-2-amino-N-(2-bromo-3-chlorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 103479404 |
| Molecular Formula | C11H14BrClN2O |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | (2R)-2-amino-N-(2-bromo-3-chlorophenyl)-3-methylbutanamide |
| SMILES | CC(C)[C@@H](N)C(=O)Nc1cccc(Cl)c1Br |
| InChI | InChI=1S/C11H14BrClN2O/c1-6(2)10(14)11(16)15-8-5-3-4-7(13)9(8)12/h3-6,10H,14H2,1-2H3,(H,15,16)/t10-/m1/s1 |
| InChIKey | AUCKGWYTZFMZJQ-SNVBAGLBSA-N |
| XLogP | 3.02 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |