C34H38N2O6 — CID 10348020
(E)-3-[2,4-bis(1,3-benzodioxol-5-yl)-3-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]cyclobutyl]-1-piperidin-1-ylprop-2-en-1-one (PubChem CID 10348020) has the molecular formula C34H38N2O6 and a molecular weight of 570.69 g/mol. Its IUPAC name is (E)-3-[2,4-bis(1,3-benzodioxol-5-yl)-3-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]cyclobutyl]-1-piperidin-1-ylprop-2-en-1-one.
| Compound Name | (E)-3-[2,4-bis(1,3-benzodioxol-5-yl)-3-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]cyclobutyl]-1-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 10348020 |
| Molecular Formula | C34H38N2O6 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | (E)-3-[2,4-bis(1,3-benzodioxol-5-yl)-3-[(E)-3-oxo-3-piperidin-1-ylprop-1-enyl]cyclobutyl]-1-piperidin-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/C1C(c2ccc3c(c2)OCO3)C(/C=C/C(=O)N2CCCCC2)C1c1ccc2c(c1)OCO2)N1CCCCC1 |
| InChI | InChI=1S/C34H38N2O6/c37-31(35-15-3-1-4-16-35)13-9-25-33(23-7-11-27-29(19-23)41-21-39-27)26(10-14-32(38)36-17-5-2-6-18-36)34(25)24-8-12-28-30(20-24)42-22-40-28/h7-14,19-20,25-26,33-34H,1-6,15-18,21-22H2/b13-9+,14-10+ |
| InChIKey | WXSSVJXPONXCFP-UTLPMFLDSA-N |
| XLogP | 5.39 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|