C12H9Br2ClN2 — CID 103481305
5-bromo-N-(2-bromo-3-chlorophenyl)-3-methylpyridin-2-amine (PubChem CID 103481305) has the molecular formula C12H9Br2ClN2 and a molecular weight of 376.48 g/mol. Its IUPAC name is 5-bromo-N-(2-bromo-3-chlorophenyl)-3-methylpyridin-2-amine.
| Compound Name | 5-bromo-N-(2-bromo-3-chlorophenyl)-3-methylpyridin-2-amine |
|---|---|
| PubChem CID | 103481305 |
| Molecular Formula | C12H9Br2ClN2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 373.88 |
| IUPAC Name | 5-bromo-N-(2-bromo-3-chlorophenyl)-3-methylpyridin-2-amine |
| SMILES | Cc1cc(Br)cnc1Nc1cccc(Cl)c1Br |
| InChI | InChI=1S/C12H9Br2ClN2/c1-7-5-8(13)6-16-12(7)17-10-4-2-3-9(15)11(10)14/h2-6H,1H3,(H,16,17) |
| InChIKey | LFHUBRSNEXJMMB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |