C34H48N4O4 — CID 10348158
2,5-bis[6-[(2-methoxyphenyl)methylamino]hexylamino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 10348158) has the molecular formula C34H48N4O4 and a molecular weight of 576.78 g/mol. Its IUPAC name is 2,5-bis[6-[(2-methoxyphenyl)methylamino]hexylamino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-bis[6-[(2-methoxyphenyl)methylamino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10348158 |
| Molecular Formula | C34H48N4O4 |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.37 |
| IUPAC Name | 2,5-bis[6-[(2-methoxyphenyl)methylamino]hexylamino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | COc1ccccc1CNCCCCCCNC1=CC(=O)C(NCCCCCCNCc2ccccc2OC)=CC1=O |
| InChI | InChI=1S/C34H48N4O4/c1-41-33-17-9-7-15-27(33)25-35-19-11-3-5-13-21-37-29-23-32(40)30(24-31(29)39)38-22-14-6-4-12-20-36-26-28-16-8-10-18-34(28)42-2/h7-10,15-18,23-24,35-38H,3-6,11-14,19-22,25-26H2,1-2H3 |
| InChIKey | WGCPPVBZEQSYPG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|