C33H58O6Si — CID 10348206
methyl (3R)-7-[(1S,2S,4aR,6S,8S,8aS)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-2-propan-2-yl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate (PubChem CID 10348206) has the molecular formula C33H58O6Si and a molecular weight of 578.91 g/mol. Its IUPAC name is methyl (3R)-7-[(1S,2S,4aR,6S,8S,8aS)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-2-propan-2-yl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate.
| Compound Name | methyl (3R)-7-[(1S,2S,4aR,6S,8S,8aS)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-2-propan-2-yl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate |
|---|---|
| PubChem CID | 10348206 |
| Molecular Formula | C33H58O6Si |
| Molecular Weight | 578.91 g/mol |
| Exact Mass | 578.40 |
| IUPAC Name | methyl (3R)-7-[(1S,2S,4aR,6S,8S,8aS)-6-methyl-8-[(2S)-2-methylbutanoyl]oxy-2-propan-2-yl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-5-oxoheptanoate |
| SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C[C@@H]2C=CC(C(C)C)[C@H](CCC(=O)C[C@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)[C@@H]12 |
| InChI | InChI=1S/C33H58O6Si/c1-12-23(5)32(36)38-29-18-22(4)17-24-13-15-27(21(2)3)28(31(24)29)16-14-25(34)19-26(20-30(35)37-9)39-40(10,11)33(6,7)8/h13,15,21-24,26-29,31H,12,14,16-20H2,1-11H3/t22-,23-,24-,26+,27?,28-,29-,31-/m0/s1 |
| InChIKey | AKBRYWUEDVAVQE-BNIVEDSXSA-N |
| XLogP | 7.76 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.91 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|