C11H17N3O2 — CID 103483489
3-(2-ethoxyethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 103483489) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 3-(2-ethoxyethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 103483489 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 3-(2-ethoxyethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CCOCCn1cnc2c(c1=O)CCNC2 |
| InChI | InChI=1S/C11H17N3O2/c1-2-16-6-5-14-8-13-10-7-12-4-3-9(10)11(14)15/h8,12H,2-7H2,1H3 |
| InChIKey | CMUPNSWTARDPQN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|