C12H19N3O2 — CID 103483530
3-(4-methoxybutyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 103483530) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(4-methoxybutyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 3-(4-methoxybutyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 103483530 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 3-(4-methoxybutyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COCCCCn1cnc2c(c1=O)CCNC2 |
| InChI | InChI=1S/C12H19N3O2/c1-17-7-3-2-6-15-9-14-11-8-13-5-4-10(11)12(15)16/h9,13H,2-8H2,1H3 |
| InChIKey | CBQYMVCSXYMFIL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|