C14H23N3O4 — CID 103483684
3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 103483684) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 103483684 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COCCOCCOCCn1cnc2c(c1=O)CCNC2 |
| InChI | InChI=1S/C14H23N3O4/c1-19-6-7-21-9-8-20-5-4-17-11-16-13-10-15-3-2-12(13)14(17)18/h11,15H,2-10H2,1H3 |
| InChIKey | ALUPYFRXAVCMMO-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|