C35H50N4O4+2 — CID 10348407
[2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium (PubChem CID 10348407) has the molecular formula C35H50N4O4+2 and a molecular weight of 590.81 g/mol. Its IUPAC name is [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium.
| Compound Name | [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium |
|---|---|
| PubChem CID | 10348407 |
| Molecular Formula | C35H50N4O4+2 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | [2,2-dimethyl-3-(5-methyl-1,3-dioxoisoindol-2-yl)propyl]-[6-[3-(1,3-dioxoisoindol-2-yl)propyl-dimethylazaniumyl]hexyl]-dimethylazanium |
| SMILES | Cc1ccc2c(c1)C(=O)N(CC(C)(C)C[N+](C)(C)CCCCCC[N+](C)(C)CCCN1C(=O)c3ccccc3C1=O)C2=O |
| InChI | InChI=1S/C35H50N4O4/c1-26-17-18-29-30(23-26)34(43)37(33(29)42)24-35(2,3)25-39(6,7)21-13-9-8-12-20-38(4,5)22-14-19-36-31(40)27-15-10-11-16-28(27)32(36)41/h10-11,15-18,23H,8-9,12-14,19-22,24-25H2,1-7H3/q+2 |
| InChIKey | ATQGKVAWXJGKDO-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|