C10H8BrFN4O3S — CID 103484074
5-[(4-bromo-5-fluoro-2-nitrophenoxy)methyl]-N-methyl-1,3,4-thiadiazol-2-amine (PubChem CID 103484074) has the molecular formula C10H8BrFN4O3S and a molecular weight of 363.17 g/mol. Its IUPAC name is 5-[(4-bromo-5-fluoro-2-nitrophenoxy)methyl]-N-methyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(4-bromo-5-fluoro-2-nitrophenoxy)methyl]-N-methyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 103484074 |
| Molecular Formula | C10H8BrFN4O3S |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 5-[(4-bromo-5-fluoro-2-nitrophenoxy)methyl]-N-methyl-1,3,4-thiadiazol-2-amine |
| SMILES | CNc1nnc(COc2cc(F)c(Br)cc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H8BrFN4O3S/c1-13-10-15-14-9(20-10)4-19-8-3-6(12)5(11)2-7(8)16(17)18/h2-3H,4H2,1H3,(H,13,15) |
| InChIKey | RTMVGWJHADVSPQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|